C22H31N3O3 — CID 95795747
3-[(3R,3aR,7aS)-1-(cyclobutanecarbonyl)-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]propanamide (PubChem CID 95795747) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-[(3R,3aR,7aS)-1-(cyclobutanecarbonyl)-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]propanamide.
| Compound Name | 3-[(3R,3aR,7aS)-1-(cyclobutanecarbonyl)-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]propanamide |
|---|---|
| PubChem CID | 95795747 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 3-[(3R,3aR,7aS)-1-(cyclobutanecarbonyl)-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]propanamide |
| SMILES | COc1ccc([C@@H]2CN(C(=O)C3CCC3)[C@H]3CCN(CCC(N)=O)C[C@@H]23)cc1 |
| InChI | InChI=1S/C22H31N3O3/c1-28-17-7-5-15(6-8-17)18-14-25(22(27)16-3-2-4-16)20-9-11-24(13-19(18)20)12-10-21(23)26/h5-8,16,18-20H,2-4,9-14H2,1H3,(H2,23,26)/t18-,19-,20-/m0/s1 |
| InChIKey | FDGDXNSSNPMLKS-UFYCRDLUSA-N |
| XLogP | 1.99 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |