C29H32N2O2 — CID 92562056
[(3S,3aS,7aR)-3-(4-methoxyphenyl)-5-[(2-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone (PubChem CID 92562056) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(4-methoxyphenyl)-5-[(2-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone.
| Compound Name | [(3S,3aS,7aR)-3-(4-methoxyphenyl)-5-[(2-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 92562056 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | [(3S,3aS,7aR)-3-(4-methoxyphenyl)-5-[(2-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone |
| SMILES | COc1ccc([C@H]2CN(C(=O)c3ccccc3)[C@@H]3CCN(Cc4ccccc4C)C[C@H]23)cc1 |
| InChI | InChI=1S/C29H32N2O2/c1-21-8-6-7-11-24(21)18-30-17-16-28-27(19-30)26(22-12-14-25(33-2)15-13-22)20-31(28)29(32)23-9-4-3-5-10-23/h3-15,26-28H,16-20H2,1-2H3/t26-,27-,28-/m1/s1 |
| InChIKey | XXCBTOFZDBRSMP-JCYYIGJDSA-N |
| XLogP | 5.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |