C26H25F2N3O — CID 53378287
[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-[(2-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-2-ylmethanone (PubChem CID 53378287) has the molecular formula C26H25F2N3O and a molecular weight of 433.50 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(4-fluorophenyl)-5-[(2-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3S,3aS,7aR)-3-(4-fluorophenyl)-5-[(2-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 53378287 |
| Molecular Formula | C26H25F2N3O |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [(3S,3aS,7aR)-3-(4-fluorophenyl)-5-[(2-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1C[C@H](c2ccc(F)cc2)[C@H]2CN(Cc3ccccc3F)CC[C@H]21 |
| InChI | InChI=1S/C26H25F2N3O/c27-20-10-8-18(9-11-20)21-17-31(26(32)24-7-3-4-13-29-24)25-12-14-30(16-22(21)25)15-19-5-1-2-6-23(19)28/h1-11,13,21-22,25H,12,14-17H2/t21-,22-,25-/m1/s1 |
| InChIKey | XUONSORQRSVRCB-TZBSWOFLSA-N |
| XLogP | 4.49 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |