C24H24FN3OS — CID 92571299
[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone (PubChem CID 92571299) has the molecular formula C24H24FN3OS and a molecular weight of 421.54 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 92571299 |
| Molecular Formula | C24H24FN3OS |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1C[C@H](c2ccc(F)cc2)[C@H]2CN(Cc3cccs3)CC[C@H]21 |
| InChI | InChI=1S/C24H24FN3OS/c25-19-5-3-17(4-6-19)21-16-28(24(29)18-7-10-26-11-8-18)23-9-12-27(15-22(21)23)14-20-2-1-13-30-20/h1-8,10-11,13,21-23H,9,12,14-16H2/t21-,22-,23-/m1/s1 |
| InChIKey | VFCNBDDHJIKDHC-DNVJHFABSA-N |
| XLogP | 4.41 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |