C27H26FN3O2 — CID 92574091
1-[(3R,3aR,7aS)-1-benzoyl-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-pyridin-3-ylethanone (PubChem CID 92574091) has the molecular formula C27H26FN3O2 and a molecular weight of 443.52 g/mol. Its IUPAC name is 1-[(3R,3aR,7aS)-1-benzoyl-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[(3R,3aR,7aS)-1-benzoyl-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 92574091 |
| Molecular Formula | C27H26FN3O2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-[(3R,3aR,7aS)-1-benzoyl-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1CC[C@H]2[C@@H](C1)[C@H](c1ccc(F)cc1)CN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H26FN3O2/c28-22-10-8-20(9-11-22)23-18-31(27(33)21-6-2-1-3-7-21)25-12-14-30(17-24(23)25)26(32)15-19-5-4-13-29-16-19/h1-11,13,16,23-25H,12,14-15,17-18H2/t23-,24-,25-/m0/s1 |
| InChIKey | RBAARTSGXYQPSG-SDHOMARFSA-N |
| XLogP | 3.92 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |