C24H22FN3O2S — CID 92577099
[(3R,3aR,7aS)-3-(4-fluorophenyl)-1-(thiophene-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone (PubChem CID 92577099) has the molecular formula C24H22FN3O2S and a molecular weight of 435.52 g/mol. Its IUPAC name is [(3R,3aR,7aS)-3-(4-fluorophenyl)-1-(thiophene-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3R,3aR,7aS)-3-(4-fluorophenyl)-1-(thiophene-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 92577099 |
| Molecular Formula | C24H22FN3O2S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | [(3R,3aR,7aS)-3-(4-fluorophenyl)-1-(thiophene-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CC[C@H]2[C@@H](C1)[C@H](c1ccc(F)cc1)CN2C(=O)c1cccs1 |
| InChI | InChI=1S/C24H22FN3O2S/c25-17-8-6-16(7-9-17)18-15-28(24(30)22-5-3-13-31-22)21-10-12-27(14-19(18)21)23(29)20-4-1-2-11-26-20/h1-9,11,13,18-19,21H,10,12,14-15H2/t18-,19-,21-/m0/s1 |
| InChIKey | KDPJFJOBZHDDHZ-ZJOUEHCJSA-N |
| XLogP | 4.05 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |