C26H25ClFN3O — CID 71532162
[(3S,3aS,7aR)-5-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone (PubChem CID 71532162) has the molecular formula C26H25ClFN3O and a molecular weight of 449.96 g/mol. Its IUPAC name is [(3S,3aS,7aR)-5-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [(3S,3aS,7aR)-5-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 71532162 |
| Molecular Formula | C26H25ClFN3O |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [(3S,3aS,7aR)-5-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1C[C@H](c2ccc(F)cc2)[C@H]2CN(Cc3cccc(Cl)c3)CC[C@H]21 |
| InChI | InChI=1S/C26H25ClFN3O/c27-21-3-1-2-18(14-21)15-30-13-10-25-24(16-30)23(19-4-6-22(28)7-5-19)17-31(25)26(32)20-8-11-29-12-9-20/h1-9,11-12,14,23-25H,10,13,15-17H2/t23-,24-,25-/m1/s1 |
| InChIKey | DOPMTJFVNVNVAL-UBFVSLLYSA-N |
| XLogP | 5.00 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |