C28H29FN2O2 — CID 92600284
[(3S,3aS,7aR)-5-[(3-fluorophenyl)methyl]-3-(3-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone (PubChem CID 92600284) has the molecular formula C28H29FN2O2 and a molecular weight of 444.55 g/mol. Its IUPAC name is [(3S,3aS,7aR)-5-[(3-fluorophenyl)methyl]-3-(3-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone.
| Compound Name | [(3S,3aS,7aR)-5-[(3-fluorophenyl)methyl]-3-(3-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 92600284 |
| Molecular Formula | C28H29FN2O2 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | [(3S,3aS,7aR)-5-[(3-fluorophenyl)methyl]-3-(3-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone |
| SMILES | COc1cccc([C@H]2CN(C(=O)c3ccccc3)[C@@H]3CCN(Cc4cccc(F)c4)C[C@H]23)c1 |
| InChI | InChI=1S/C28H29FN2O2/c1-33-24-12-6-10-22(16-24)25-19-31(28(32)21-8-3-2-4-9-21)27-13-14-30(18-26(25)27)17-20-7-5-11-23(29)15-20/h2-12,15-16,25-27H,13-14,17-19H2,1H3/t25-,26-,27-/m1/s1 |
| InChIKey | MZACGVDQGOVDNR-ZONZVBGPSA-N |
| XLogP | 4.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |