C25H24F2N2OS — CID 92572411
[(3S,3aS,7aR)-5-[(3-fluorophenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 92572411) has the molecular formula C25H24F2N2OS and a molecular weight of 438.54 g/mol. Its IUPAC name is [(3S,3aS,7aR)-5-[(3-fluorophenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(3S,3aS,7aR)-5-[(3-fluorophenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 92572411 |
| Molecular Formula | C25H24F2N2OS |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [(3S,3aS,7aR)-5-[(3-fluorophenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1C[C@H](c2ccsc2)[C@H]2CN(Cc3cccc(F)c3)CC[C@H]21 |
| InChI | InChI=1S/C25H24F2N2OS/c26-19-5-3-4-17(12-19)13-28-10-8-24-22(14-28)21(18-9-11-31-16-18)15-29(24)25(30)20-6-1-2-7-23(20)27/h1-7,9,11-12,16,21-22,24H,8,10,13-15H2/t21-,22-,24-/m1/s1 |
| InChIKey | GBGZDJCJJQDXQX-CQOQZXRMSA-N |
| XLogP | 5.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |