C24H29FN2OS — CID 92572408
[(3S,3aS,7aR)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 92572408) has the molecular formula C24H29FN2OS and a molecular weight of 412.57 g/mol. Its IUPAC name is [(3S,3aS,7aR)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(3S,3aS,7aR)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 92572408 |
| Molecular Formula | C24H29FN2OS |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [(3S,3aS,7aR)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1C[C@H](c2ccsc2)[C@H]2CN(C3CCCCC3)CC[C@H]21 |
| InChI | InChI=1S/C24H29FN2OS/c25-22-9-5-4-8-19(22)24(28)27-15-20(17-11-13-29-16-17)21-14-26(12-10-23(21)27)18-6-2-1-3-7-18/h4-5,8-9,11,13,16,18,20-21,23H,1-3,6-7,10,12,14-15H2/t20-,21-,23-/m1/s1 |
| InChIKey | MHUGXOPZZCWBDU-MQSCRBSSSA-N |
| XLogP | 5.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |