C24H30N2OS — CID 92574107
[(3R,3aR,7aS)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone (PubChem CID 92574107) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is [(3R,3aR,7aS)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone.
| Compound Name | [(3R,3aR,7aS)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 92574107 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [(3R,3aR,7aS)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C[C@@H](c2ccsc2)[C@@H]2CN(C3CCCCC3)CC[C@@H]21 |
| InChI | InChI=1S/C24H30N2OS/c27-24(18-7-3-1-4-8-18)26-16-21(19-12-14-28-17-19)22-15-25(13-11-23(22)26)20-9-5-2-6-10-20/h1,3-4,7-8,12,14,17,20-23H,2,5-6,9-11,13,15-16H2/t21-,22-,23-/m0/s1 |
| InChIKey | NNMYSLYYJIACQG-VABKMULXSA-N |
| XLogP | 5.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |