C21H25FN2OS — CID 92585510
1-[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]propan-1-one (PubChem CID 92585510) has the molecular formula C21H25FN2OS and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]propan-1-one.
| Compound Name | 1-[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 92585510 |
| Molecular Formula | C21H25FN2OS |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1C[C@H](c2ccc(F)cc2)[C@H]2CN(Cc3ccsc3)CC[C@H]21 |
| InChI | InChI=1S/C21H25FN2OS/c1-2-21(25)24-13-18(16-3-5-17(22)6-4-16)19-12-23(9-7-20(19)24)11-15-8-10-26-14-15/h3-6,8,10,14,18-20H,2,7,9,11-13H2,1H3/t18-,19-,20-/m1/s1 |
| InChIKey | COCDWLASLFUSME-VAMGGRTRSA-N |
| XLogP | 4.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |