C17H24N2OS — CID 42454210
[(4aR,8aR)-6-(thiophen-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclopropylmethanone (PubChem CID 42454210) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is [(4aR,8aR)-6-(thiophen-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclopropylmethanone.
| Compound Name | [(4aR,8aR)-6-(thiophen-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 42454210 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [(4aR,8aR)-6-(thiophen-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCC[C@@H]2CN(Cc3ccsc3)CC[C@H]21 |
| InChI | InChI=1S/C17H24N2OS/c20-17(14-3-4-14)19-7-1-2-15-11-18(8-5-16(15)19)10-13-6-9-21-12-13/h6,9,12,14-16H,1-5,7-8,10-11H2/t15-,16-/m1/s1 |
| InChIKey | XODXLMAJIZGQQZ-HZPDHXFCSA-N |
| XLogP | 2.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |