C22H28N2OS — CID 126465227
1-[(4aR,8aR)-6-(thiophen-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(2-methylphenyl)ethanone (PubChem CID 126465227) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is 1-[(4aR,8aR)-6-(thiophen-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(2-methylphenyl)ethanone.
| Compound Name | 1-[(4aR,8aR)-6-(thiophen-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 126465227 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-[(4aR,8aR)-6-(thiophen-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1CC(=O)N1CCC[C@@H]2CN(Cc3ccsc3)CC[C@H]21 |
| InChI | InChI=1S/C22H28N2OS/c1-17-5-2-3-6-19(17)13-22(25)24-10-4-7-20-15-23(11-8-21(20)24)14-18-9-12-26-16-18/h2-3,5-6,9,12,16,20-21H,4,7-8,10-11,13-15H2,1H3/t20-,21-/m1/s1 |
| InChIKey | ZJJWLPSOJSAQIC-NHCUHLMSSA-N |
| XLogP | 4.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |