C23H28N2OS — CID 126464611
1-[(4aR,8aR)-6-[(E)-3-phenylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-thiophen-3-ylethanone (PubChem CID 126464611) has the molecular formula C23H28N2OS and a molecular weight of 380.56 g/mol. Its IUPAC name is 1-[(4aR,8aR)-6-[(E)-3-phenylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(4aR,8aR)-6-[(E)-3-phenylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 126464611 |
| Molecular Formula | C23H28N2OS |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 1-[(4aR,8aR)-6-[(E)-3-phenylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CCC[C@@H]2CN(C/C=C/c3ccccc3)CC[C@H]21 |
| InChI | InChI=1S/C23H28N2OS/c26-23(16-20-11-15-27-18-20)25-13-5-9-21-17-24(14-10-22(21)25)12-4-8-19-6-2-1-3-7-19/h1-4,6-8,11,15,18,21-22H,5,9-10,12-14,16-17H2/b8-4+/t21-,22-/m1/s1 |
| InChIKey | DDCGRFSWKRWUTH-DOTZPFNOSA-N |
| XLogP | 4.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |