C16H22N2O2S — CID 110124806
(4aR,9aR)-5-methyl-1-(2-thiophen-3-ylacetyl)-2,3,4,4a,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one (PubChem CID 110124806) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is (4aR,9aR)-5-methyl-1-(2-thiophen-3-ylacetyl)-2,3,4,4a,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one.
| Compound Name | (4aR,9aR)-5-methyl-1-(2-thiophen-3-ylacetyl)-2,3,4,4a,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one |
|---|---|
| PubChem CID | 110124806 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (4aR,9aR)-5-methyl-1-(2-thiophen-3-ylacetyl)-2,3,4,4a,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one |
| SMILES | CN1C(=O)CCC[C@@H]2[C@H]1CCCN2C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C16H22N2O2S/c1-17-13-5-3-8-18(14(13)4-2-6-15(17)19)16(20)10-12-7-9-21-11-12/h7,9,11,13-14H,2-6,8,10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | PZMJYFIFSCTGKM-ZIAGYGMSSA-N |
| XLogP | 2.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |