C17H24N2O2S — CID 110126122
(4aS,9aS)-1,9a-dimethyl-5-(2-thiophen-3-ylacetyl)-4,4a,6,7,8,9-hexahydro-3H-pyrido[3,2-b]azepin-2-one (PubChem CID 110126122) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is (4aS,9aS)-1,9a-dimethyl-5-(2-thiophen-3-ylacetyl)-4,4a,6,7,8,9-hexahydro-3H-pyrido[3,2-b]azepin-2-one.
| Compound Name | (4aS,9aS)-1,9a-dimethyl-5-(2-thiophen-3-ylacetyl)-4,4a,6,7,8,9-hexahydro-3H-pyrido[3,2-b]azepin-2-one |
|---|---|
| PubChem CID | 110126122 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (4aS,9aS)-1,9a-dimethyl-5-(2-thiophen-3-ylacetyl)-4,4a,6,7,8,9-hexahydro-3H-pyrido[3,2-b]azepin-2-one |
| SMILES | CN1C(=O)CC[C@@H]2N(C(=O)Cc3ccsc3)CCCC[C@@]21C |
| InChI | InChI=1S/C17H24N2O2S/c1-17-8-3-4-9-19(14(17)5-6-15(20)18(17)2)16(21)11-13-7-10-22-12-13/h7,10,12,14H,3-6,8-9,11H2,1-2H3/t14-,17-/m0/s1 |
| InChIKey | SSPRLOTVQXOEIA-YOEHRIQHSA-N |
| XLogP | 2.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |