C22H25F2N3O — CID 26348657
1-[(4aR,8aS)-6-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(2,3-difluorophenyl)ethanone (PubChem CID 26348657) has the molecular formula C22H25F2N3O and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(2,3-difluorophenyl)ethanone.
| Compound Name | 1-[(4aR,8aS)-6-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(2,3-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 26348657 |
| Molecular Formula | C22H25F2N3O |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[(4aR,8aS)-6-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(2,3-difluorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1F)N1CCC[C@@H]2CN(Cc3ccccn3)CC[C@@H]21 |
| InChI | InChI=1S/C22H25F2N3O/c23-19-8-3-5-16(22(19)24)13-21(28)27-11-4-6-17-14-26(12-9-20(17)27)15-18-7-1-2-10-25-18/h1-3,5,7-8,10,17,20H,4,6,9,11-15H2/t17-,20+/m1/s1 |
| InChIKey | APRVXGKGPBFECD-XLIONFOSSA-N |
| XLogP | 3.42 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |