C23H34N2O — CID 56855222
[(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohexylmethanone (PubChem CID 56855222) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is [(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohexylmethanone.
| Compound Name | [(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 56855222 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | [(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)N1CCC[C@@H]2CN(CCc3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C23H34N2O/c26-23(20-10-5-2-6-11-20)25-15-7-12-21-18-24(17-14-22(21)25)16-13-19-8-3-1-4-9-19/h1,3-4,8-9,20-22H,2,5-7,10-18H2/t21-,22+/m1/s1 |
| InChIKey | JNIHFGXYTCMZSN-YADHBBJMSA-N |
| XLogP | 4.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |