C24H30N2OS — CID 45219517
[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohex-3-en-1-ylmethanone (PubChem CID 45219517) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is [(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohex-3-en-1-ylmethanone.
| Compound Name | [(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohex-3-en-1-ylmethanone |
|---|---|
| PubChem CID | 45219517 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohex-3-en-1-ylmethanone |
| SMILES | O=C(C1CC=CCC1)N1CCC[C@@H]2CN(Cc3cc4ccccc4s3)CC[C@@H]21 |
| InChI | InChI=1S/C24H30N2OS/c27-24(18-7-2-1-3-8-18)26-13-6-10-20-16-25(14-12-22(20)26)17-21-15-19-9-4-5-11-23(19)28-21/h1-2,4-5,9,11,15,18,20,22H,3,6-8,10,12-14,16-17H2/t18?,20-,22+/m1/s1 |
| InChIKey | MVXYJICCKWAGFT-DLJNSJNUSA-N |
| XLogP | 5.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|