C24H32N4OS2 — CID 26350267
1-[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]ethanone (PubChem CID 26350267) has the molecular formula C24H32N4OS2 and a molecular weight of 456.68 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]ethanone.
| Compound Name | 1-[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]ethanone |
|---|---|
| PubChem CID | 26350267 |
| Molecular Formula | C24H32N4OS2 |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 1-[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]ethanone |
| SMILES | C[C@@H]1C[C@@H](CC(=O)N2CCC[C@@H]3CN(Cc4cc5ccccc5s4)CC[C@@H]32)NC(=S)N1 |
| InChI | InChI=1S/C24H32N4OS2/c1-16-11-19(26-24(30)25-16)13-23(29)28-9-4-6-18-14-27(10-8-21(18)28)15-20-12-17-5-2-3-7-22(17)31-20/h2-3,5,7,12,16,18-19,21H,4,6,8-11,13-15H2,1H3,(H2,25,26,30)/t16-,18-,19+,21+/m1/s1 |
| InChIKey | SONVUNATUCGRCE-RBAQFSTRSA-N |
| XLogP | 3.73 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|