C22H28N2O2S — CID 26340342
[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-[(3R)-oxolan-3-yl]methanone (PubChem CID 26340342) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is [(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-[(3R)-oxolan-3-yl]methanone.
| Compound Name | [(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-[(3R)-oxolan-3-yl]methanone |
|---|---|
| PubChem CID | 26340342 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-[(3R)-oxolan-3-yl]methanone |
| SMILES | O=C([C@@H]1CCOC1)N1CCC[C@@H]2CN(Cc3cc4ccccc4s3)CC[C@@H]21 |
| InChI | InChI=1S/C22H28N2O2S/c25-22(18-8-11-26-15-18)24-9-3-5-17-13-23(10-7-20(17)24)14-19-12-16-4-1-2-6-21(16)27-19/h1-2,4,6,12,17-18,20H,3,5,7-11,13-15H2/t17-,18-,20+/m1/s1 |
| InChIKey | GVNFVMZNMBHVOP-GGPKGHCWSA-N |
| XLogP | 3.75 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |