C24H36N2O2 — CID 42287691
(4-hydroxycyclohexyl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone (PubChem CID 42287691) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is (4-hydroxycyclohexyl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone.
| Compound Name | (4-hydroxycyclohexyl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42287691 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | (4-hydroxycyclohexyl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CCC(O)CC1)N1CCC([C@@H]2CCN(CCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C24H36N2O2/c27-23-8-6-21(7-9-23)24(28)26-16-12-20(13-17-26)22-11-15-25(18-22)14-10-19-4-2-1-3-5-19/h1-5,20-23,27H,6-18H2/t21?,22-,23?/m1/s1 |
| InChIKey | OBAUUKNVHVFOCX-OOMBGRCJSA-N |
| XLogP | 3.34 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |