C23H30N2O2 — CID 26316106
(3-methylfuran-2-yl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone (PubChem CID 26316106) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is (3-methylfuran-2-yl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone.
| Compound Name | (3-methylfuran-2-yl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 26316106 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (3-methylfuran-2-yl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone |
| SMILES | Cc1ccoc1C(=O)N1CCC([C@@H]2CCN(CCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-18-11-16-27-22(18)23(26)25-14-9-20(10-15-25)21-8-13-24(17-21)12-7-19-5-3-2-4-6-19/h2-6,11,16,20-21H,7-10,12-15,17H2,1H3/t21-/m1/s1 |
| InChIKey | FEPQCRKOAPSEOQ-OAQYLSRUSA-N |
| XLogP | 4.00 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |