C18H29N3O3 — CID 124804015
[(5aS,9aR)-4-[2-(dimethylamino)ethyl]-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(3-methylfuran-2-yl)methanone (PubChem CID 124804015) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is [(5aS,9aR)-4-[2-(dimethylamino)ethyl]-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(3-methylfuran-2-yl)methanone.
| Compound Name | [(5aS,9aR)-4-[2-(dimethylamino)ethyl]-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(3-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 124804015 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | [(5aS,9aR)-4-[2-(dimethylamino)ethyl]-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(3-methylfuran-2-yl)methanone |
| SMILES | Cc1ccoc1C(=O)N1CC[C@H]2CN(CCN(C)C)CCO[C@H]2C1 |
| InChI | InChI=1S/C18H29N3O3/c1-14-5-10-24-17(14)18(22)21-6-4-15-12-20(8-7-19(2)3)9-11-23-16(15)13-21/h5,10,15-16H,4,6-9,11-13H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | HCZQQCYZZOVNOX-HOTGVXAUSA-N |
| XLogP | 1.31 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |