C18H22N2O4 — CID 124893636
[(5aR,8aR)-4-(furan-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(3-methylfuran-2-yl)methanone (PubChem CID 124893636) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is [(5aR,8aR)-4-(furan-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(3-methylfuran-2-yl)methanone.
| Compound Name | [(5aR,8aR)-4-(furan-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(3-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 124893636 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [(5aR,8aR)-4-(furan-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(3-methylfuran-2-yl)methanone |
| SMILES | Cc1ccoc1C(=O)N1C[C@H]2CN(Cc3ccoc3)CCO[C@H]2C1 |
| InChI | InChI=1S/C18H22N2O4/c1-13-2-6-24-17(13)18(21)20-10-15-9-19(4-7-23-16(15)11-20)8-14-3-5-22-12-14/h2-3,5-6,12,15-16H,4,7-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | PMQGKROUHLAVCG-CVEARBPZSA-N |
| XLogP | 2.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |