C17H22N4O3 — CID 97420328
[(5aS,8aS)-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(furan-2-yl)methanone (PubChem CID 97420328) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is [(5aS,8aS)-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(furan-2-yl)methanone.
| Compound Name | [(5aS,8aS)-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 97420328 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [(5aS,8aS)-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(furan-2-yl)methanone |
| SMILES | Cn1cc(CN2CCO[C@@H]3CN(C(=O)c4ccco4)C[C@@H]3C2)cn1 |
| InChI | InChI=1S/C17H22N4O3/c1-19-8-13(7-18-19)9-20-4-6-24-16-12-21(11-14(16)10-20)17(22)15-3-2-5-23-15/h2-3,5,7-8,14,16H,4,6,9-12H2,1H3/t14-,16+/m0/s1 |
| InChIKey | OHLMFPHBKSJCRH-GOEBONIOSA-N |
| XLogP | 0.99 |
| TPSA | 63.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |