C17H25N3O3 — CID 97377474
[(4aR,7aS)-4-(2-pyrrolidin-1-ylethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(furan-2-yl)methanone (PubChem CID 97377474) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is [(4aR,7aS)-4-(2-pyrrolidin-1-ylethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(furan-2-yl)methanone.
| Compound Name | [(4aR,7aS)-4-(2-pyrrolidin-1-ylethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 97377474 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | [(4aR,7aS)-4-(2-pyrrolidin-1-ylethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1C[C@@H]2OCCN(CCN3CCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C17H25N3O3/c21-17(15-4-3-10-22-15)20-12-14-16(13-20)23-11-9-19(14)8-7-18-5-1-2-6-18/h3-4,10,14,16H,1-2,5-9,11-13H2/t14-,16+/m1/s1 |
| InChIKey | KOQOSEYRLAOFAD-ZBFHGGJFSA-N |
| XLogP | 0.90 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |