C19H26F3N3O4S — CID 171696715
[(4aR,7aS)-4-(2-pyrrolidin-1-ylethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 171696715) has the molecular formula C19H26F3N3O4S and a molecular weight of 449.50 g/mol. Its IUPAC name is [(4aR,7aS)-4-(2-pyrrolidin-1-ylethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aR,7aS)-4-(2-pyrrolidin-1-ylethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171696715 |
| Molecular Formula | C19H26F3N3O4S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | [(4aR,7aS)-4-(2-pyrrolidin-1-ylethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cccs1)N1C[C@@H]2OCCN(CCN3CCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C17H25N3O2S.C2HF3O2/c21-17(16-4-3-11-23-16)20-12-14-15(13-20)22-10-9-19(14)8-7-18-5-1-2-6-18;3-2(4,5)1(6)7/h3-4,11,14-15H,1-2,5-10,12-13H2;(H,6,7)/t14-,15+;/m1./s1 |
| InChIKey | FGZAVRCUGFLKCQ-LIOBNPLQSA-N |
| XLogP | 2.00 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |