C17H20N2O3S — CID 124790066
[(5aS,8aR)-7-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(furan-2-yl)methanone (PubChem CID 124790066) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is [(5aS,8aR)-7-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(furan-2-yl)methanone.
| Compound Name | [(5aS,8aR)-7-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 124790066 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [(5aS,8aR)-7-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCO[C@H]2CN(Cc3cccs3)C[C@H]2C1 |
| InChI | InChI=1S/C17H20N2O3S/c20-17(15-4-1-6-21-15)19-5-7-22-16-12-18(9-13(16)10-19)11-14-3-2-8-23-14/h1-4,6,8,13,16H,5,7,9-12H2/t13-,16-/m0/s1 |
| InChIKey | KTAJTOVOQZBPDH-BBRMVZONSA-N |
| XLogP | 2.31 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |