C21H26N4O6S — CID 155870115
[(5aS,8aS)-4-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5,6-dimethylpyrimidin-4-yl)methanone;oxalic acid (PubChem CID 155870115) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is [(5aS,8aS)-4-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5,6-dimethylpyrimidin-4-yl)methanone;oxalic acid.
| Compound Name | [(5aS,8aS)-4-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5,6-dimethylpyrimidin-4-yl)methanone;oxalic acid |
|---|---|
| PubChem CID | 155870115 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [(5aS,8aS)-4-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5,6-dimethylpyrimidin-4-yl)methanone;oxalic acid |
| SMILES | Cc1ncnc(C(=O)N2C[C@@H]3CN(Cc4cccs4)CCO[C@@H]3C2)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24N4O2S.C2H2O4/c1-13-14(2)20-12-21-18(13)19(24)23-9-15-8-22(5-6-25-17(15)11-23)10-16-4-3-7-26-16;3-1(4)2(5)6/h3-4,7,12,15,17H,5-6,8-11H2,1-2H3;(H,3,4)(H,5,6)/t15-,17+;/m0./s1 |
| InChIKey | PASXAZZPWPHPSG-KPVRICSOSA-N |
| XLogP | 1.28 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|