C19H23N3O8S — CID 155870069
[(5aS,8aS)-4-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(3-methoxy-1,2-oxazol-5-yl)methanone;oxalic acid (PubChem CID 155870069) has the molecular formula C19H23N3O8S and a molecular weight of 453.47 g/mol. Its IUPAC name is [(5aS,8aS)-4-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(3-methoxy-1,2-oxazol-5-yl)methanone;oxalic acid.
| Compound Name | [(5aS,8aS)-4-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(3-methoxy-1,2-oxazol-5-yl)methanone;oxalic acid |
|---|---|
| PubChem CID | 155870069 |
| Molecular Formula | C19H23N3O8S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [(5aS,8aS)-4-(thiophen-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(3-methoxy-1,2-oxazol-5-yl)methanone;oxalic acid |
| SMILES | COc1cc(C(=O)N2C[C@@H]3CN(Cc4cccs4)CCO[C@@H]3C2)on1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H21N3O4S.C2H2O4/c1-22-16-7-14(24-18-16)17(21)20-9-12-8-19(4-5-23-15(12)11-20)10-13-3-2-6-25-13;3-1(4)2(5)6/h2-3,6-7,12,15H,4-5,8-11H2,1H3;(H,3,4)(H,5,6)/t12-,15+;/m0./s1 |
| InChIKey | KMACWDVKXXDBJO-SBKWZQTDSA-N |
| XLogP | 0.87 |
| TPSA | 142.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|