C20H23F3N2O6 — CID 155829144
[(5aR,9aS)-8-(furan-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-4-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155829144) has the molecular formula C20H23F3N2O6 and a molecular weight of 444.41 g/mol. Its IUPAC name is [(5aR,9aS)-8-(furan-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-4-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(5aR,9aS)-8-(furan-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-4-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829144 |
| Molecular Formula | C20H23F3N2O6 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [(5aR,9aS)-8-(furan-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-4-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccco1)N1CCO[C@@H]2CN(Cc3ccoc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C18H22N2O4.C2HF3O2/c21-18(16-2-1-7-23-16)20-6-9-24-17-12-19(5-3-15(17)11-20)10-14-4-8-22-13-14;3-2(4,5)1(6)7/h1-2,4,7-8,13,15,17H,3,5-6,9-12H2;(H,6,7)/t15-,17-;/m1./s1 |
| InChIKey | AKPQQIKFHDHKKT-SSPJITILSA-N |
| XLogP | 2.87 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |