C22H24F4N2O5 — CID 127022635
(5aR,9aR)-4-[(3-fluorophenyl)methyl]-8-(furan-3-ylmethyl)-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 127022635) has the molecular formula C22H24F4N2O5 and a molecular weight of 472.44 g/mol. Its IUPAC name is (5aR,9aR)-4-[(3-fluorophenyl)methyl]-8-(furan-3-ylmethyl)-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5aR,9aR)-4-[(3-fluorophenyl)methyl]-8-(furan-3-ylmethyl)-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022635 |
| Molecular Formula | C22H24F4N2O5 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (5aR,9aR)-4-[(3-fluorophenyl)methyl]-8-(furan-3-ylmethyl)-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1[C@@H]2CCN(Cc3ccoc3)C[C@@H]2OCCN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H23FN2O3.C2HF3O2/c21-17-3-1-2-15(10-17)12-23-7-9-26-19-13-22(6-4-18(19)20(23)24)11-16-5-8-25-14-16;3-2(4,5)1(6)7/h1-3,5,8,10,14,18-19H,4,6-7,9,11-13H2;(H,6,7)/t18-,19+;/m1./s1 |
| InChIKey | XVFOJOXBDLRLRZ-VOMIJIAVSA-N |
| XLogP | 3.30 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |