C21H26F4N2O4 — CID 155826925
N-[[(1S,3aR,7aR)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]cyclopropanecarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826925) has the molecular formula C21H26F4N2O4 and a molecular weight of 446.44 g/mol. Its IUPAC name is N-[[(1S,3aR,7aR)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]cyclopropanecarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(1S,3aR,7aR)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]cyclopropanecarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826925 |
| Molecular Formula | C21H26F4N2O4 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[[(1S,3aR,7aR)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]cyclopropanecarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC[C@H]1OC[C@H]2CN(Cc3cccc(F)c3)CC[C@H]21)C1CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25FN2O2.C2HF3O2/c20-16-3-1-2-13(8-16)10-22-7-6-17-15(11-22)12-24-18(17)9-21-19(23)14-4-5-14;3-2(4,5)1(6)7/h1-3,8,14-15,17-18H,4-7,9-12H2,(H,21,23);(H,6,7)/t15-,17-,18-;/m1./s1 |
| InChIKey | BXYSKLBRNJXPAT-GUCVWDHMSA-N |
| XLogP | 2.82 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |