C22H31F3N2O5 — CID 155843433
2-[(1R,3aR,7aR)-5-[(3-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155843433) has the molecular formula C22H31F3N2O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2-[(1R,3aR,7aR)-5-[(3-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(1R,3aR,7aR)-5-[(3-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843433 |
| Molecular Formula | C22H31F3N2O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 2-[(1R,3aR,7aR)-5-[(3-methylphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)C[C@H]1OC[C@H]2CN(Cc3cccc(C)c3)CC[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H30N2O3.C2HF3O2/c1-15-4-3-5-16(10-15)12-22-8-6-18-17(13-22)14-25-19(18)11-20(23)21-7-9-24-2;3-2(4,5)1(6)7/h3-5,10,17-19H,6-9,11-14H2,1-2H3,(H,21,23);(H,6,7)/t17-,18-,19-;/m1./s1 |
| InChIKey | AKQUXAVSNDLBQV-OYXQGUJPSA-N |
| XLogP | 2.62 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|