C22H29F6N3O7 — CID 171686109
2-[(3aR,7S,7aS)-2-(pyridin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(2-methoxyethyl)acetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171686109) has the molecular formula C22H29F6N3O7 and a molecular weight of 561.48 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-(pyridin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(2-methoxyethyl)acetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(3aR,7S,7aS)-2-(pyridin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(2-methoxyethyl)acetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171686109 |
| Molecular Formula | C22H29F6N3O7 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-(pyridin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(2-methoxyethyl)acetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCNC(=O)C[C@@H]1COC[C@H]2CN(Cc3ccncc3)C[C@@H]12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O3.2C2HF3O2/c1-23-7-6-20-18(22)8-15-12-24-13-16-10-21(11-17(15)16)9-14-2-4-19-5-3-14;2*3-2(4,5)1(6)7/h2-5,15-17H,6-13H2,1H3,(H,20,22);2*(H,6,7)/t15-,16-,17+;;/m1../s1 |
| InChIKey | KYKRNCGAERGBBF-HREQYLLUSA-N |
| XLogP | 2.20 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|