C19H27F3N4O5 — CID 155848631
2-[(3aR,7S,7aS)-2-(6-methylpyridazin-3-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155848631) has the molecular formula C19H27F3N4O5 and a molecular weight of 448.44 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-(6-methylpyridazin-3-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aR,7S,7aS)-2-(6-methylpyridazin-3-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848631 |
| Molecular Formula | C19H27F3N4O5 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-(6-methylpyridazin-3-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)C[C@@H]1COC[C@H]2CN(c3ccc(C)nn3)C[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O3.C2HF3O2/c1-12-3-4-16(20-19-12)21-8-14-11-24-10-13(15(14)9-21)7-17(22)18-5-6-23-2;3-2(4,5)1(6)7/h3-4,13-15H,5-11H2,1-2H3,(H,18,22);(H,6,7)/t13-,14-,15+;/m1./s1 |
| InChIKey | BFDJMAMHLYXPIM-QRWISWEOSA-N |
| XLogP | 1.27 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|