C23H31F3N2O5 — CID 155836827
2-[(3aR,7S,7aS)-2-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(cyclopropylmethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155836827) has the molecular formula C23H31F3N2O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(cyclopropylmethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aR,7S,7aS)-2-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(cyclopropylmethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155836827 |
| Molecular Formula | C23H31F3N2O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N-(cyclopropylmethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2C[C@@H]3COC[C@@H](CC(=O)NCC4CC4)[C@@H]3C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H30N2O3.C2HF3O2/c1-25-19-6-4-16(5-7-19)10-23-11-18-14-26-13-17(20(18)12-23)8-21(24)22-9-15-2-3-15;3-2(4,5)1(6)7/h4-7,15,17-18,20H,2-3,8-14H2,1H3,(H,22,24);(H,6,7)/t17-,18-,20+;/m1./s1 |
| InChIKey | NKCKULXNNXSJLF-CCAFVWFJSA-N |
| XLogP | 2.94 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |