C20H26F6N2O5 — CID 155848954
(3aS,7S,7aR)-2-benzyl-N,N-dimethyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155848954) has the molecular formula C20H26F6N2O5 and a molecular weight of 488.43 g/mol. Its IUPAC name is (3aS,7S,7aR)-2-benzyl-N,N-dimethyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,7S,7aR)-2-benzyl-N,N-dimethyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155848954 |
| Molecular Formula | C20H26F6N2O5 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (3aS,7S,7aR)-2-benzyl-N,N-dimethyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)[C@@H]1COC[C@@H]2CN(Cc3ccccc3)C[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N2O.2C2HF3O2/c1-17(2)16-12-19-11-14-9-18(10-15(14)16)8-13-6-4-3-5-7-13;2*3-2(4,5)1(6)7/h3-7,14-16H,8-12H2,1-2H3;2*(H,6,7)/t14-,15-,16+;;/m0../s1 |
| InChIKey | URYSCRZBORIKIO-WKXLSLHPSA-N |
| XLogP | 2.96 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |