C21H26F4N2O5 — CID 155827216
[(3aR,7S,7aR)-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155827216) has the molecular formula C21H26F4N2O5 and a molecular weight of 462.44 g/mol. Its IUPAC name is [(3aR,7S,7aR)-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7S,7aR)-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827216 |
| Molecular Formula | C21H26F4N2O5 |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [(3aR,7S,7aR)-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([C@@H]1COC[C@H]2CN(Cc3cccc(F)c3)C[C@H]21)N1CCCCO1 |
| InChI | InChI=1S/C19H25FN2O3.C2HF3O2/c20-16-5-3-4-14(8-16)9-21-10-15-12-24-13-18(17(15)11-21)19(23)22-6-1-2-7-25-22;3-2(4,5)1(6)7/h3-5,8,15,17-18H,1-2,6-7,9-13H2;(H,6,7)/t15-,17-,18-;/m1./s1 |
| InChIKey | PEOHUCJCGXNDKM-GUCVWDHMSA-N |
| XLogP | 2.71 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |