C20H27F3N2O6 — CID 127021806
[(3aR,7R,7aR)-2-[(5-methylfuran-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127021806) has the molecular formula C20H27F3N2O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is [(3aR,7R,7aR)-2-[(5-methylfuran-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7R,7aR)-2-[(5-methylfuran-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021806 |
| Molecular Formula | C20H27F3N2O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [(3aR,7R,7aR)-2-[(5-methylfuran-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2C[C@@H]3COC[C@H](C(=O)N4CCCCO4)[C@@H]3C2)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N2O4.C2HF3O2/c1-13-4-5-15(24-13)9-19-8-14-11-22-12-17(16(14)10-19)18(21)20-6-2-3-7-23-20;3-2(4,5)1(6)7/h4-5,14,16-17H,2-3,6-12H2,1H3;(H,6,7)/t14-,16-,17+;/m1./s1 |
| InChIKey | WOLUXPWJJRDAQU-WBWOGKSNSA-N |
| XLogP | 2.47 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |