C16H23F3N2O6S — CID 127023124
N-[(3aR,7R,7aS)-2-[(5-methylfuran-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 127023124) has the molecular formula C16H23F3N2O6S and a molecular weight of 428.43 g/mol. Its IUPAC name is N-[(3aR,7R,7aS)-2-[(5-methylfuran-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3aR,7R,7aS)-2-[(5-methylfuran-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023124 |
| Molecular Formula | C16H23F3N2O6S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[(3aR,7R,7aS)-2-[(5-methylfuran-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2C[C@@H]3COC[C@H](NS(C)(=O)=O)[C@@H]3C2)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N2O4S.C2HF3O2/c1-10-3-4-12(20-10)6-16-5-11-8-19-9-14(13(11)7-16)15-21(2,17)18;3-2(4,5)1(6)7/h3-4,11,13-15H,5-9H2,1-2H3;(H,6,7)/t11-,13-,14+;/m1./s1 |
| InChIKey | PTHPWDDAIMIJAW-DSNOOMGLSA-N |
| XLogP | 1.22 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |