C17H24F3N3O6S — CID 155861363
(2R,3aR,6aR)-N-methyl-5-[(5-methylfuran-2-yl)methyl]-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155861363) has the molecular formula C17H24F3N3O6S and a molecular weight of 455.46 g/mol. Its IUPAC name is (2R,3aR,6aR)-N-methyl-5-[(5-methylfuran-2-yl)methyl]-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aR,6aR)-N-methyl-5-[(5-methylfuran-2-yl)methyl]-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155861363 |
| Molecular Formula | C17H24F3N3O6S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (2R,3aR,6aR)-N-methyl-5-[(5-methylfuran-2-yl)methyl]-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@H]1C[C@@H]2CN(Cc3ccc(C)o3)C[C@@H]2N1S(C)(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O4S.C2HF3O2/c1-10-4-5-12(22-10)8-17-7-11-6-13(15(19)16-2)18(14(11)9-17)23(3,20)21;3-2(4,5)1(6)7/h4-5,11,13-14H,6-9H2,1-3H3,(H,16,19);(H,6,7)/t11-,13-,14+;/m1./s1 |
| InChIKey | IJUXVDNXEYKWNT-DSNOOMGLSA-N |
| XLogP | 0.80 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |