C19H24F3N3O4 — CID 155840819
(2R,3aR,6aR)-1-acetyl-5-benzyl-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155840819) has the molecular formula C19H24F3N3O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-acetyl-5-benzyl-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aR,6aR)-1-acetyl-5-benzyl-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155840819 |
| Molecular Formula | C19H24F3N3O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2R,3aR,6aR)-1-acetyl-5-benzyl-N-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@H]1C[C@@H]2CN(Cc3ccccc3)C[C@@H]2N1C(C)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N3O2.C2HF3O2/c1-12(21)20-15(17(22)18-2)8-14-10-19(11-16(14)20)9-13-6-4-3-5-7-13;3-2(4,5)1(6)7/h3-7,14-16H,8-11H2,1-2H3,(H,18,22);(H,6,7)/t14-,15-,16+;/m1./s1 |
| InChIKey | DNBVYPQUSKOYNU-IFKKJYDISA-N |
| XLogP | 1.49 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |