C17H21F3N2O5 — CID 155856725
(4aR,7aR)-6-[(5-methylfuran-2-yl)methyl]-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one;2,2,2-trifluoroacetic acid (PubChem CID 155856725) has the molecular formula C17H21F3N2O5 and a molecular weight of 390.36 g/mol. Its IUPAC name is (4aR,7aR)-6-[(5-methylfuran-2-yl)methyl]-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | (4aR,7aR)-6-[(5-methylfuran-2-yl)methyl]-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155856725 |
| Molecular Formula | C17H21F3N2O5 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (4aR,7aR)-6-[(5-methylfuran-2-yl)methyl]-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN1C(=O)CO[C@@H]2CN(Cc3ccc(C)o3)C[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H20N2O3.C2HF3O2/c1-3-6-17-13-8-16(7-12-5-4-11(2)20-12)9-14(13)19-10-15(17)18;3-2(4,5)1(6)7/h3-5,13-14H,1,6-10H2,2H3;(H,6,7)/t13-,14-;/m1./s1 |
| InChIKey | OQIPKNQNVYXRGG-DTPOWOMPSA-N |
| XLogP | 1.82 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|