C15H20N2O4 — CID 131683016
(4aR,7aR)-6-[(1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 131683016) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is (4aR,7aR)-6-[(1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aR,7aR)-6-[(1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 131683016 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (4aR,7aR)-6-[(1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-4-prop-2-enyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | C=CCN1C(=O)CO[C@@H]2CN(C(=O)C3[C@H]4COC[C@@H]34)C[C@H]21 |
| InChI | InChI=1S/C15H20N2O4/c1-2-3-17-11-4-16(5-12(11)21-8-13(17)18)15(19)14-9-6-20-7-10(9)14/h2,9-12,14H,1,3-8H2/t9-,10+,11-,12-,14?/m1/s1 |
| InChIKey | HLTNCBISUFVTTO-HMMZJVQESA-N |
| XLogP | -0.50 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|