C19H25N3O3 — CID 56775224
(4aR,7aS)-4-(cyclohexylmethyl)-6-(pyridine-3-carbonyl)-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 56775224) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (4aR,7aS)-4-(cyclohexylmethyl)-6-(pyridine-3-carbonyl)-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aR,7aS)-4-(cyclohexylmethyl)-6-(pyridine-3-carbonyl)-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 56775224 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (4aR,7aS)-4-(cyclohexylmethyl)-6-(pyridine-3-carbonyl)-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | O=C(c1cccnc1)N1C[C@@H]2OCC(=O)N(CC3CCCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C19H25N3O3/c23-18-13-25-17-12-21(19(24)15-7-4-8-20-9-15)11-16(17)22(18)10-14-5-2-1-3-6-14/h4,7-9,14,16-17H,1-3,5-6,10-13H2/t16-,17+/m1/s1 |
| InChIKey | BEHKEQCBPLDXNO-SJORKVTESA-N |
| XLogP | 1.71 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |