C22H27F7N2O5 — CID 155823554
(3aS,6aR)-2-[(3-fluorophenyl)methyl]-5-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155823554) has the molecular formula C22H27F7N2O5 and a molecular weight of 532.45 g/mol. Its IUPAC name is (3aS,6aR)-2-[(3-fluorophenyl)methyl]-5-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,6aR)-2-[(3-fluorophenyl)methyl]-5-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155823554 |
| Molecular Formula | C22H27F7N2O5 |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | (3aS,6aR)-2-[(3-fluorophenyl)methyl]-5-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Fc1cccc(CN2C[C@@H]3CN(C4CCOCC4)C[C@@H]3C2)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25FN2O.2C2HF3O2/c19-17-3-1-2-14(8-17)9-20-10-15-12-21(13-16(15)11-20)18-4-6-22-7-5-18;2*3-2(4,5)1(6)7/h1-3,8,15-16,18H,4-7,9-13H2;2*(H,6,7)/t15-,16+;; |
| InChIKey | GRQNVLPFDGPCCX-TYIJTUDGSA-N |
| XLogP | 3.63 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |