C21H22F4N2O4 — CID 171673246
[2-[(3-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylfuran-3-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 171673246) has the molecular formula C21H22F4N2O4 and a molecular weight of 442.41 g/mol. Its IUPAC name is [2-[(3-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylfuran-3-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [2-[(3-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylfuran-3-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171673246 |
| Molecular Formula | C21H22F4N2O4 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [2-[(3-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylfuran-3-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1occc1C(=O)N1CC2CN(Cc3cccc(F)c3)CC2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21FN2O2.C2HF3O2/c1-13-18(5-6-24-13)19(23)22-11-15-9-21(10-16(15)12-22)8-14-3-2-4-17(20)7-14;3-2(4,5)1(6)7/h2-7,15-16H,8-12H2,1H3;(H,6,7) |
| InChIKey | RBYLBHZYMCXSMB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |